C23H33N3O2 — CID 120984003
1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)-N-benzylpiperidine-4-carboxamide (PubChem CID 120984003) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)-N-benzylpiperidine-4-carboxamide.
| Compound Name | 1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)-N-benzylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120984003 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)-N-benzylpiperidine-4-carboxamide |
| SMILES | NC1C2CCCC1CC(C(=O)N1CCC(C(=O)NCc3ccccc3)CC1)C2 |
| InChI | InChI=1S/C23H33N3O2/c24-21-18-7-4-8-19(21)14-20(13-18)23(28)26-11-9-17(10-12-26)22(27)25-15-16-5-2-1-3-6-16/h1-3,5-6,17-21H,4,7-15,24H2,(H,25,27) |
| InChIKey | YWDMGWDLGNQLMO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |