C22H35ClN2O3 — CID 120986011
9-amino-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride (PubChem CID 120986011) has the molecular formula C22H35ClN2O3 and a molecular weight of 410.99 g/mol. Its IUPAC name is 9-amino-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride.
| Compound Name | 9-amino-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120986011 |
| Molecular Formula | C22H35ClN2O3 |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 9-amino-N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
| SMILES | CCOCCOCc1cccc(CNC(=O)C2CC3CCCC(C2)C3N)c1.Cl |
| InChI | InChI=1S/C22H34N2O3.ClH/c1-2-26-9-10-27-15-17-6-3-5-16(11-17)14-24-22(25)20-12-18-7-4-8-19(13-20)21(18)23;/h3,5-6,11,18-21H,2,4,7-10,12-15,23H2,1H3,(H,24,25);1H |
| InChIKey | OKIGMRIDQIPDGT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|