C10H12F3N3O3 — CID 120986285
2-amino-3-methoxy-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]propanamide (PubChem CID 120986285) has the molecular formula C10H12F3N3O3 and a molecular weight of 279.22 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]propanamide.
| Compound Name | 2-amino-3-methoxy-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]propanamide |
|---|---|
| PubChem CID | 120986285 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-amino-3-methoxy-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]propanamide |
| SMILES | COCC(N)C(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C10H12F3N3O3/c1-19-4-6(14)8(17)16-7-2-5(10(11,12)13)3-15-9(7)18/h2-3,6H,4,14H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | UFBPFHKUFBTLSU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |