C20H29ClN2O — CID 120988072
9-amino-N-(1-phenylcyclobutyl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride (PubChem CID 120988072) has the molecular formula C20H29ClN2O and a molecular weight of 348.92 g/mol. Its IUPAC name is 9-amino-N-(1-phenylcyclobutyl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride.
| Compound Name | 9-amino-N-(1-phenylcyclobutyl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120988072 |
| Molecular Formula | C20H29ClN2O |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 9-amino-N-(1-phenylcyclobutyl)bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
| SMILES | Cl.NC1C2CCCC1CC(C(=O)NC1(c3ccccc3)CCC1)C2 |
| InChI | InChI=1S/C20H28N2O.ClH/c21-18-14-6-4-7-15(18)13-16(12-14)19(23)22-20(10-5-11-20)17-8-2-1-3-9-17;/h1-3,8-9,14-16,18H,4-7,10-13,21H2,(H,22,23);1H |
| InChIKey | NTPDMZYIYBWWIO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |