C15H21F3N2O3 — CID 120988650
2-amino-3-methoxy-N-[[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 120988650) has the molecular formula C15H21F3N2O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 2-amino-3-methoxy-N-[[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 120988650 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-amino-3-methoxy-N-[[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | COCC(N)C(=O)NCc1ccc(OC(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O3/c1-9(2)23-11-5-4-10(12(6-11)15(16,17)18)7-20-14(21)13(19)8-22-3/h4-6,9,13H,7-8,19H2,1-3H3,(H,20,21) |
| InChIKey | HKRHBUZKGKLAMP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |