C12H22ClF3N2O2 — CID 120992063
2-amino-3-methoxy-N-[[3-(trifluoromethyl)cyclohexyl]methyl]propanamide;hydrochloride (PubChem CID 120992063) has the molecular formula C12H22ClF3N2O2 and a molecular weight of 318.77 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[[3-(trifluoromethyl)cyclohexyl]methyl]propanamide;hydrochloride.
| Compound Name | 2-amino-3-methoxy-N-[[3-(trifluoromethyl)cyclohexyl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120992063 |
| Molecular Formula | C12H22ClF3N2O2 |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-amino-3-methoxy-N-[[3-(trifluoromethyl)cyclohexyl]methyl]propanamide;hydrochloride |
| SMILES | COCC(N)C(=O)NCC1CCCC(C(F)(F)F)C1.Cl |
| InChI | InChI=1S/C12H21F3N2O2.ClH/c1-19-7-10(16)11(18)17-6-8-3-2-4-9(5-8)12(13,14)15;/h8-10H,2-7,16H2,1H3,(H,17,18);1H |
| InChIKey | UNOBGACVJVZEBC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |