C12H20F3NO — CID 67953222
2-methyl-N-[[3-(trifluoromethyl)cyclohexyl]methyl]propanamide (PubChem CID 67953222) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-methyl-N-[[3-(trifluoromethyl)cyclohexyl]methyl]propanamide.
| Compound Name | 2-methyl-N-[[3-(trifluoromethyl)cyclohexyl]methyl]propanamide |
|---|---|
| PubChem CID | 67953222 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-methyl-N-[[3-(trifluoromethyl)cyclohexyl]methyl]propanamide |
| SMILES | CC(C)C(=O)NCC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3NO/c1-8(2)11(17)16-7-9-4-3-5-10(6-9)12(13,14)15/h8-10H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | IZISMNIIOPNICF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |