C13H23F3N2O — CID 64755259
2-methyl-N-[2-[[4-(trifluoromethyl)cyclohexyl]amino]ethyl]propanamide (PubChem CID 64755259) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-methyl-N-[2-[[4-(trifluoromethyl)cyclohexyl]amino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[4-(trifluoromethyl)cyclohexyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 64755259 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-methyl-N-[2-[[4-(trifluoromethyl)cyclohexyl]amino]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCNC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3N2O/c1-9(2)12(19)18-8-7-17-11-5-3-10(4-6-11)13(14,15)16/h9-11,17H,3-8H2,1-2H3,(H,18,19) |
| InChIKey | RUFFPOFMRWCEPA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|