C20H28ClN3O3 — CID 120993785
9-amino-N-cyclopropyl-N-[(4-nitrophenyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride (PubChem CID 120993785) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is 9-amino-N-cyclopropyl-N-[(4-nitrophenyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride.
| Compound Name | 9-amino-N-cyclopropyl-N-[(4-nitrophenyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120993785 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 9-amino-N-cyclopropyl-N-[(4-nitrophenyl)methyl]bicyclo[3.3.1]nonane-3-carboxamide;hydrochloride |
| SMILES | Cl.NC1C2CCCC1CC(C(=O)N(Cc1ccc([N+](=O)[O-])cc1)C1CC1)C2 |
| InChI | InChI=1S/C20H27N3O3.ClH/c21-19-14-2-1-3-15(19)11-16(10-14)20(24)22(17-8-9-17)12-13-4-6-18(7-5-13)23(25)26;/h4-7,14-17,19H,1-3,8-12,21H2;1H |
| InChIKey | VXGJRKIHFSAMTQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|