C18H28ClN3O2 — CID 120996072
2-(4-methoxyphenyl)-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one;hydrochloride (PubChem CID 120996072) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120996072 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one;hydrochloride |
| SMILES | COc1ccc(C(C)C(=O)N2CCC(N3CCNCC3)C2)cc1.Cl |
| InChI | InChI=1S/C18H27N3O2.ClH/c1-14(15-3-5-17(23-2)6-4-15)18(22)21-10-7-16(13-21)20-11-8-19-9-12-20;/h3-6,14,16,19H,7-13H2,1-2H3;1H |
| InChIKey | JSTMESTZNOMDTH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |