C19H33N5O2 — CID 120997458
(3-piperazin-1-ylpyrrolidin-1-yl)-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]methanone (PubChem CID 120997458) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is (3-piperazin-1-ylpyrrolidin-1-yl)-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]methanone.
| Compound Name | (3-piperazin-1-ylpyrrolidin-1-yl)-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 120997458 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | (3-piperazin-1-ylpyrrolidin-1-yl)-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(C(=O)N2CCCC2)CC1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C19H33N5O2/c25-18(24-12-5-17(15-24)21-13-6-20-7-14-21)16-3-10-23(11-4-16)19(26)22-8-1-2-9-22/h16-17,20H,1-15H2 |
| InChIKey | YOJQOLQBLZETJT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |