C13H18ClF3N2O2S — CID 120999521
N-piperidin-3-yl-1-[2-(trifluoromethyl)phenyl]methanesulfonamide;hydrochloride (PubChem CID 120999521) has the molecular formula C13H18ClF3N2O2S and a molecular weight of 358.81 g/mol. Its IUPAC name is N-piperidin-3-yl-1-[2-(trifluoromethyl)phenyl]methanesulfonamide;hydrochloride.
| Compound Name | N-piperidin-3-yl-1-[2-(trifluoromethyl)phenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120999521 |
| Molecular Formula | C13H18ClF3N2O2S |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-piperidin-3-yl-1-[2-(trifluoromethyl)phenyl]methanesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccccc1C(F)(F)F)NC1CCCNC1 |
| InChI | InChI=1S/C13H17F3N2O2S.ClH/c14-13(15,16)12-6-2-1-4-10(12)9-21(19,20)18-11-5-3-7-17-8-11;/h1-2,4,6,11,17-18H,3,5,7-9H2;1H |
| InChIKey | PGXSIAXYTDYLPO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |