C14H20F3N3O2S — CID 120999796
N-(2-piperazin-1-ylethyl)-1-[2-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 120999796) has the molecular formula C14H20F3N3O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)-1-[2-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-(2-piperazin-1-ylethyl)-1-[2-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 120999796 |
| Molecular Formula | C14H20F3N3O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)-1-[2-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1C(F)(F)F)NCCN1CCNCC1 |
| InChI | InChI=1S/C14H20F3N3O2S/c15-14(16,17)13-4-2-1-3-12(13)11-23(21,22)19-7-10-20-8-5-18-6-9-20/h1-4,18-19H,5-11H2 |
| InChIKey | JEUOMPBUVFJPRE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |