C12H9Br2NO2 — CID 121001131
(4,5-dibromo-1H-pyrrol-2-yl)-(2-methoxyphenyl)methanone (PubChem CID 121001131) has the molecular formula C12H9Br2NO2 and a molecular weight of 359.02 g/mol. Its IUPAC name is (4,5-dibromo-1H-pyrrol-2-yl)-(2-methoxyphenyl)methanone.
| Compound Name | (4,5-dibromo-1H-pyrrol-2-yl)-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 121001131 |
| Molecular Formula | C12H9Br2NO2 |
| Molecular Weight | 359.02 g/mol |
| Exact Mass | 356.90 |
| IUPAC Name | (4,5-dibromo-1H-pyrrol-2-yl)-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)c1cc(Br)c(Br)[nH]1 |
| InChI | InChI=1S/C12H9Br2NO2/c1-17-10-5-3-2-4-7(10)11(16)9-6-8(13)12(14)15-9/h2-6,15H,1H3 |
| InChIKey | CYLCCXLRDIOREX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.02 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |