C12H8Br2O2S — CID 79602326
(3,4-dibromothiophen-2-yl)-(2-methoxyphenyl)methanone (PubChem CID 79602326) has the molecular formula C12H8Br2O2S and a molecular weight of 376.07 g/mol. Its IUPAC name is (3,4-dibromothiophen-2-yl)-(2-methoxyphenyl)methanone.
| Compound Name | (3,4-dibromothiophen-2-yl)-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 79602326 |
| Molecular Formula | C12H8Br2O2S |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 373.86 |
| IUPAC Name | (3,4-dibromothiophen-2-yl)-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)c1scc(Br)c1Br |
| InChI | InChI=1S/C12H8Br2O2S/c1-16-9-5-3-2-4-7(9)11(15)12-10(14)8(13)6-17-12/h2-6H,1H3 |
| InChIKey | CVYZVNQXBBRINH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |