C12H17NO6 — CID 121002904
[3-(acetyloxymethyl)-5-ethyl-6-oxo-2H-1,4-oxazin-3-yl]methyl acetate (PubChem CID 121002904) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-5-ethyl-6-oxo-2H-1,4-oxazin-3-yl]methyl acetate.
| Compound Name | [3-(acetyloxymethyl)-5-ethyl-6-oxo-2H-1,4-oxazin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 121002904 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [3-(acetyloxymethyl)-5-ethyl-6-oxo-2H-1,4-oxazin-3-yl]methyl acetate |
| SMILES | CCC1=NC(COC(C)=O)(COC(C)=O)COC1=O |
| InChI | InChI=1S/C12H17NO6/c1-4-10-11(16)19-7-12(13-10,5-17-8(2)14)6-18-9(3)15/h4-7H2,1-3H3 |
| InChIKey | GRBFPRAWBOUXOG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|