C11H15NO6 — CID 121006261
[3-(acetyloxymethyl)-5-methyl-6-oxo-2H-1,4-oxazin-3-yl]methyl acetate (PubChem CID 121006261) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-5-methyl-6-oxo-2H-1,4-oxazin-3-yl]methyl acetate.
| Compound Name | [3-(acetyloxymethyl)-5-methyl-6-oxo-2H-1,4-oxazin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 121006261 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [3-(acetyloxymethyl)-5-methyl-6-oxo-2H-1,4-oxazin-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1(COC(C)=O)COC(=O)C(C)=N1 |
| InChI | InChI=1S/C11H15NO6/c1-7-10(15)18-6-11(12-7,4-16-8(2)13)5-17-9(3)14/h4-6H2,1-3H3 |
| InChIKey | ORCGSCMKJLIESL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|