C12H15N5O4S — CID 121002992
(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[[2-(1,2,4-triazol-1-yl)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 121002992) has the molecular formula C12H15N5O4S and a molecular weight of 325.35 g/mol. Its IUPAC name is (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[[2-(1,2,4-triazol-1-yl)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[[2-(1,2,4-triazol-1-yl)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 121002992 |
| Molecular Formula | C12H15N5O4S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[[2-(1,2,4-triazol-1-yl)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)Cn3cncn3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C12H15N5O4S/c1-12(2)8(11(20)21)17-9(19)7(10(17)22-12)15-6(18)3-16-5-13-4-14-16/h4-5,7-8,10H,3H2,1-2H3,(H,15,18)(H,20,21)/t7-,8+,10-/m1/s1 |
| InChIKey | RSJVXUDEYZUCPU-KHQFGBGNSA-N |
| XLogP | -1.09 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |