C12H15N3O6 — CID 121003307
diethyl 4-(carbamoylhydrazinylidene)pyran-2,6-dicarboxylate (PubChem CID 121003307) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is diethyl 4-(carbamoylhydrazinylidene)pyran-2,6-dicarboxylate.
| Compound Name | diethyl 4-(carbamoylhydrazinylidene)pyran-2,6-dicarboxylate |
|---|---|
| PubChem CID | 121003307 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | diethyl 4-(carbamoylhydrazinylidene)pyran-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(=NNC(N)=O)cc(C(=O)OCC)o1 |
| InChI | InChI=1S/C12H15N3O6/c1-3-19-10(16)8-5-7(14-15-12(13)18)6-9(21-8)11(17)20-4-2/h5-6H,3-4H2,1-2H3,(H3,13,15,18) |
| InChIKey | AVIURFMXIGPZCQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|