C15H14O3 — CID 10331966
ethyl 4,5-dihydrobenzo[e][1]benzofuran-2-carboxylate (PubChem CID 10331966) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl 4,5-dihydrobenzo[e][1]benzofuran-2-carboxylate.
| Compound Name | ethyl 4,5-dihydrobenzo[e][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 10331966 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | ethyl 4,5-dihydrobenzo[e][1]benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(o1)CCc1ccccc1-2 |
| InChI | InChI=1S/C15H14O3/c1-2-17-15(16)14-9-12-11-6-4-3-5-10(11)7-8-13(12)18-14/h3-6,9H,2,7-8H2,1H3 |
| InChIKey | MSAMFPDJHZMMRV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |