C22H20N2O4 — CID 137389187
ethyl 6-(4-aminobenzoyl)-4,5-dihydrofuro[3,2-d][1]benzazepine-2-carboxylate (PubChem CID 137389187) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl 6-(4-aminobenzoyl)-4,5-dihydrofuro[3,2-d][1]benzazepine-2-carboxylate.
| Compound Name | ethyl 6-(4-aminobenzoyl)-4,5-dihydrofuro[3,2-d][1]benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 137389187 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | ethyl 6-(4-aminobenzoyl)-4,5-dihydrofuro[3,2-d][1]benzazepine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(o1)-c1ccccc1N(C(=O)c1ccc(N)cc1)CC2 |
| InChI | InChI=1S/C22H20N2O4/c1-2-27-22(26)19-13-15-11-12-24(21(25)14-7-9-16(23)10-8-14)18-6-4-3-5-17(18)20(15)28-19/h3-10,13H,2,11-12,23H2,1H3 |
| InChIKey | DGOAVDMVCRCEQM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|