C25H19FN4O5S — CID 153352465
[4,5-dimethyl-2-[6-(4-nitrobenzoyl)-4,5-dihydrofuro[3,2-d][1]benzazepine-2-carbonyl]imidazol-1-yl] thiohypofluorite (PubChem CID 153352465) has the molecular formula C25H19FN4O5S and a molecular weight of 506.52 g/mol. Its IUPAC name is [4,5-dimethyl-2-[6-(4-nitrobenzoyl)-4,5-dihydrofuro[3,2-d][1]benzazepine-2-carbonyl]imidazol-1-yl] thiohypofluorite.
| Compound Name | [4,5-dimethyl-2-[6-(4-nitrobenzoyl)-4,5-dihydrofuro[3,2-d][1]benzazepine-2-carbonyl]imidazol-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 153352465 |
| Molecular Formula | C25H19FN4O5S |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | [4,5-dimethyl-2-[6-(4-nitrobenzoyl)-4,5-dihydrofuro[3,2-d][1]benzazepine-2-carbonyl]imidazol-1-yl] thiohypofluorite |
| SMILES | Cc1nc(C(=O)c2cc3c(o2)-c2ccccc2N(C(=O)c2ccc([N+](=O)[O-])cc2)CC3)n(SF)c1C |
| InChI | InChI=1S/C25H19FN4O5S/c1-14-15(2)29(36-26)24(27-14)22(31)21-13-17-11-12-28(20-6-4-3-5-19(20)23(17)35-21)25(32)16-7-9-18(10-8-16)30(33)34/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | HFSJCADNFJGFFI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|