C23H18N2O5S — CID 155205012
5-[5-methyl-1-(4-nitrobenzoyl)-2,3-dihydro-1-benzazepin-4-yl]thiophene-2-carboxylic acid (PubChem CID 155205012) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is 5-[5-methyl-1-(4-nitrobenzoyl)-2,3-dihydro-1-benzazepin-4-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[5-methyl-1-(4-nitrobenzoyl)-2,3-dihydro-1-benzazepin-4-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 155205012 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 5-[5-methyl-1-(4-nitrobenzoyl)-2,3-dihydro-1-benzazepin-4-yl]thiophene-2-carboxylic acid |
| SMILES | CC1=C(c2ccc(C(=O)O)s2)CCN(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C23H18N2O5S/c1-14-17-4-2-3-5-19(17)24(22(26)15-6-8-16(9-7-15)25(29)30)13-12-18(14)20-10-11-21(31-20)23(27)28/h2-11H,12-13H2,1H3,(H,27,28) |
| InChIKey | UBFRLWZBRBKKPU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|