C34H29ClN4O8 — CID 160715469
4-nitrobenzoyl chloride;1-(4-nitrobenzoyl)-3,4-dihydro-2H-1-benzazepin-5-one;1,2,3,4-tetrahydro-1-benzazepin-5-one (PubChem CID 160715469) has the molecular formula C34H29ClN4O8 and a molecular weight of 657.08 g/mol. Its IUPAC name is 4-nitrobenzoyl chloride;1-(4-nitrobenzoyl)-3,4-dihydro-2H-1-benzazepin-5-one;1,2,3,4-tetrahydro-1-benzazepin-5-one.
| Compound Name | 4-nitrobenzoyl chloride;1-(4-nitrobenzoyl)-3,4-dihydro-2H-1-benzazepin-5-one;1,2,3,4-tetrahydro-1-benzazepin-5-one |
|---|---|
| PubChem CID | 160715469 |
| Molecular Formula | C34H29ClN4O8 |
| Molecular Weight | 657.08 g/mol |
| Exact Mass | 656.17 |
| IUPAC Name | 4-nitrobenzoyl chloride;1-(4-nitrobenzoyl)-3,4-dihydro-2H-1-benzazepin-5-one;1,2,3,4-tetrahydro-1-benzazepin-5-one |
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])cc1.O=C1CCCN(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc21.O=C1CCCNc2ccccc21 |
| InChI | InChI=1S/C17H14N2O4.C10H11NO.C7H4ClNO3/c20-16-6-3-11-18(15-5-2-1-4-14(15)16)17(21)12-7-9-13(10-8-12)19(22)23;12-10-6-3-7-11-9-5-2-1-4-8(9)10;8-7(10)5-1-3-6(4-2-5)9(11)12/h1-2,4-5,7-10H,3,6,11H2;1-2,4-5,11H,3,6-7H2;1-4H |
| InChIKey | RSKHPMKDKVCHNP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.08 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|