C19H18N4O4 — CID 46169377
1'-(4-nitrobenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one (PubChem CID 46169377) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 1'-(4-nitrobenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one.
| Compound Name | 1'-(4-nitrobenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 46169377 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1'-(4-nitrobenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one |
| SMILES | O=C1NC2(CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)Nc2ccccc21 |
| InChI | InChI=1S/C19H18N4O4/c24-17-15-3-1-2-4-16(15)20-19(21-17)9-11-22(12-10-19)18(25)13-5-7-14(8-6-13)23(26)27/h1-8,20H,9-12H2,(H,21,24) |
| InChIKey | BEKUZLDUXMERPL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|