C18H14N2O3S2 — CID 145380128
(12-methyl-3,13-dithia-7-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraen-7-yl)-(4-nitrophenyl)methanone (PubChem CID 145380128) has the molecular formula C18H14N2O3S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is (12-methyl-3,13-dithia-7-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraen-7-yl)-(4-nitrophenyl)methanone.
| Compound Name | (12-methyl-3,13-dithia-7-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraen-7-yl)-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 145380128 |
| Molecular Formula | C18H14N2O3S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (12-methyl-3,13-dithia-7-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraen-7-yl)-(4-nitrophenyl)methanone |
| SMILES | Cc1cc2c(s1)-c1sccc1N(C(=O)c1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C18H14N2O3S2/c1-11-10-13-6-8-19(15-7-9-24-17(15)16(13)25-11)18(21)12-2-4-14(5-3-12)20(22)23/h2-5,7,9-10H,6,8H2,1H3 |
| InChIKey | GFICCGOEIWDBNI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|