C25H16F2N2O4S2 — CID 157385047
2-(2,6-difluorophenyl)-1-[7-(2,3,5,6-tetradeuterio-4-nitrobenzoyl)-3,13-dithia-7-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraen-12-yl]ethanone (PubChem CID 157385047) has the molecular formula C25H16F2N2O4S2 and a molecular weight of 514.57 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-[7-(2,3,5,6-tetradeuterio-4-nitrobenzoyl)-3,13-dithia-7-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraen-12-yl]ethanone.
| Compound Name | 2-(2,6-difluorophenyl)-1-[7-(2,3,5,6-tetradeuterio-4-nitrobenzoyl)-3,13-dithia-7-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraen-12-yl]ethanone |
|---|---|
| PubChem CID | 157385047 |
| Molecular Formula | C25H16F2N2O4S2 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-[7-(2,3,5,6-tetradeuterio-4-nitrobenzoyl)-3,13-dithia-7-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraen-12-yl]ethanone |
| SMILES | [2H]c1c([2H])c([N+](=O)[O-])c([2H])c([2H])c1C(=O)N1CCc2cc(C(=O)Cc3c(F)cccc3F)sc2-c2sccc21 |
| InChI | InChI=1S/C25H16F2N2O4S2/c26-18-2-1-3-19(27)17(18)13-21(30)22-12-15-8-10-28(20-9-11-34-24(20)23(15)35-22)25(31)14-4-6-16(7-5-14)29(32)33/h1-7,9,11-12H,8,10,13H2/i4D,5D,6D,7D |
| InChIKey | INHULKUUERWUNB-UGWFXTGHSA-N |
| XLogP | 6.29 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|