C24H18F2N2OS — CID 58164685
2-(2,6-difluorophenyl)-1-(13-imidazol-1-yl-3-thiatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)ethanone (PubChem CID 58164685) has the molecular formula C24H18F2N2OS and a molecular weight of 420.48 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-(13-imidazol-1-yl-3-thiatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)ethanone.
| Compound Name | 2-(2,6-difluorophenyl)-1-(13-imidazol-1-yl-3-thiatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)ethanone |
|---|---|
| PubChem CID | 58164685 |
| Molecular Formula | C24H18F2N2OS |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-(13-imidazol-1-yl-3-thiatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)ethanone |
| SMILES | O=C(Cc1c(F)cccc1F)c1cc2c(s1)-c1cc(-n3ccnc3)ccc1CCC2 |
| InChI | InChI=1S/C24H18F2N2OS/c25-20-5-2-6-21(26)19(20)13-22(29)23-11-16-4-1-3-15-7-8-17(28-10-9-27-14-28)12-18(15)24(16)30-23/h2,5-12,14H,1,3-4,13H2 |
| InChIKey | BIVKDLVHYABCIF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |