C27H19FN2O4S — CID 159730946
2-(2-fluorophenyl)-1-[6-(4-nitrobenzoyl)-4,5-dihydrothieno[3,2-d][1]benzazepin-2-yl]ethanone (PubChem CID 159730946) has the molecular formula C27H19FN2O4S and a molecular weight of 486.52 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[6-(4-nitrobenzoyl)-4,5-dihydrothieno[3,2-d][1]benzazepin-2-yl]ethanone.
| Compound Name | 2-(2-fluorophenyl)-1-[6-(4-nitrobenzoyl)-4,5-dihydrothieno[3,2-d][1]benzazepin-2-yl]ethanone |
|---|---|
| PubChem CID | 159730946 |
| Molecular Formula | C27H19FN2O4S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[6-(4-nitrobenzoyl)-4,5-dihydrothieno[3,2-d][1]benzazepin-2-yl]ethanone |
| SMILES | O=C(Cc1ccccc1F)c1cc2c(s1)-c1ccccc1N(C(=O)c1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C27H19FN2O4S/c28-22-7-3-1-5-18(22)15-24(31)25-16-19-13-14-29(23-8-4-2-6-21(23)26(19)35-25)27(32)17-9-11-20(12-10-17)30(33)34/h1-12,16H,13-15H2 |
| InChIKey | LILULSYGSXSMLC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|