C22H19FN2O3S — CID 121276376
ethyl 6-(4-amino-2-fluorobenzoyl)-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate (PubChem CID 121276376) has the molecular formula C22H19FN2O3S and a molecular weight of 410.47 g/mol. Its IUPAC name is ethyl 6-(4-amino-2-fluorobenzoyl)-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate.
| Compound Name | ethyl 6-(4-amino-2-fluorobenzoyl)-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 121276376 |
| Molecular Formula | C22H19FN2O3S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | ethyl 6-(4-amino-2-fluorobenzoyl)-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(s1)-c1ccccc1N(C(=O)c1ccc(N)cc1F)CC2 |
| InChI | InChI=1S/C22H19FN2O3S/c1-2-28-22(27)19-11-13-9-10-25(18-6-4-3-5-16(18)20(13)29-19)21(26)15-8-7-14(24)12-17(15)23/h3-8,11-12H,2,9-10,24H2,1H3 |
| InChIKey | ZOJJEYADHKUEPN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|