C32H28ClN3O4S — CID 121276451
ethyl 6-[4-[(2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonyl)amino]benzoyl]-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate (PubChem CID 121276451) has the molecular formula C32H28ClN3O4S and a molecular weight of 586.11 g/mol. Its IUPAC name is ethyl 6-[4-[(2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonyl)amino]benzoyl]-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate.
| Compound Name | ethyl 6-[4-[(2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonyl)amino]benzoyl]-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 121276451 |
| Molecular Formula | C32H28ClN3O4S |
| Molecular Weight | 586.11 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | ethyl 6-[4-[(2-chloro-5,6,7,8-tetrahydroquinoline-3-carbonyl)amino]benzoyl]-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(s1)-c1ccccc1N(C(=O)c1ccc(NC(=O)c3cc4c(nc3Cl)CCCC4)cc1)CC2 |
| InChI | InChI=1S/C32H28ClN3O4S/c1-2-40-32(39)27-18-21-15-16-36(26-10-6-4-8-23(26)28(21)41-27)31(38)19-11-13-22(14-12-19)34-30(37)24-17-20-7-3-5-9-25(20)35-29(24)33/h4,6,8,10-14,17-18H,2-3,5,7,9,15-16H2,1H3,(H,34,37) |
| InChIKey | NCTXOEXBFBTZIO-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.11 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|