C12H8Br2N6O4 — CID 121003734
3-(2,4-dibromo-6-nitroanilino)pyrazine-2,5-dicarboxamide (PubChem CID 121003734) has the molecular formula C12H8Br2N6O4 and a molecular weight of 460.04 g/mol. Its IUPAC name is 3-(2,4-dibromo-6-nitroanilino)pyrazine-2,5-dicarboxamide.
| Compound Name | 3-(2,4-dibromo-6-nitroanilino)pyrazine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 121003734 |
| Molecular Formula | C12H8Br2N6O4 |
| Molecular Weight | 460.04 g/mol |
| Exact Mass | 457.90 |
| IUPAC Name | 3-(2,4-dibromo-6-nitroanilino)pyrazine-2,5-dicarboxamide |
| SMILES | NC(=O)c1cnc(C(N)=O)c(Nc2c(Br)cc(Br)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H8Br2N6O4/c13-4-1-5(14)8(7(2-4)20(23)24)19-12-9(11(16)22)17-3-6(18-12)10(15)21/h1-3H,(H2,15,21)(H2,16,22)(H,18,19) |
| InChIKey | DJHQXOKOGYOGMS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.04 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|