C12H21IOSi — CID 121003831
6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-6,7-dihydro-5H-oxasilepine (PubChem CID 121003831) has the molecular formula C12H21IOSi and a molecular weight of 336.29 g/mol. Its IUPAC name is 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-6,7-dihydro-5H-oxasilepine.
| Compound Name | 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-6,7-dihydro-5H-oxasilepine |
|---|---|
| PubChem CID | 121003831 |
| Molecular Formula | C12H21IOSi |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 6-[(Z)-5-iodopent-4-enyl]-2,2-dimethyl-6,7-dihydro-5H-oxasilepine |
| SMILES | C[Si]1(C)C=CCC(CCC/C=C\I)CO1 |
| InChI | InChI=1S/C12H21IOSi/c1-15(2)10-6-8-12(11-14-15)7-4-3-5-9-13/h5-6,9-10,12H,3-4,7-8,11H2,1-2H3/b9-5- |
| InChIKey | DEMYVDPAILHMNH-UITAMQMPSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|