C15H31IOSi — CID 46197624
tert-butyl-[(3S,5S)-6-iodo-3,5-dimethyl-2-methylidenehexoxy]-dimethylsilane (PubChem CID 46197624) has the molecular formula C15H31IOSi and a molecular weight of 382.40 g/mol. Its IUPAC name is tert-butyl-[(3S,5S)-6-iodo-3,5-dimethyl-2-methylidenehexoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3S,5S)-6-iodo-3,5-dimethyl-2-methylidenehexoxy]-dimethylsilane |
|---|---|
| PubChem CID | 46197624 |
| Molecular Formula | C15H31IOSi |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | tert-butyl-[(3S,5S)-6-iodo-3,5-dimethyl-2-methylidenehexoxy]-dimethylsilane |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@H](C)CI |
| InChI | InChI=1S/C15H31IOSi/c1-12(10-16)9-13(2)14(3)11-17-18(7,8)15(4,5)6/h12-13H,3,9-11H2,1-2,4-8H3/t12-,13-/m0/s1 |
| InChIKey | SIQCJIACCMXBMH-STQMWFEESA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|