C15H31IOSi — CID 59972081
tert-butyl-[(E,5S)-1-iodo-5-methyloct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 59972081) has the molecular formula C15H31IOSi and a molecular weight of 382.40 g/mol. Its IUPAC name is tert-butyl-[(E,5S)-1-iodo-5-methyloct-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,5S)-1-iodo-5-methyloct-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 59972081 |
| Molecular Formula | C15H31IOSi |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | tert-butyl-[(E,5S)-1-iodo-5-methyloct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCC[C@H](C)CC(/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H31IOSi/c1-8-9-13(2)12-14(10-11-16)17-18(6,7)15(3,4)5/h10-11,13-14H,8-9,12H2,1-7H3/b11-10+/t13-,14?/m0/s1 |
| InChIKey | XPKFEYHEPDZGHY-FSCOPUGXSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|