C15H29IOSi — CID 72737464
tert-butyl-[(7E)-8-iodo-7-methylocta-1,7-dien-3-yl]oxy-dimethylsilane (PubChem CID 72737464) has the molecular formula C15H29IOSi and a molecular weight of 380.39 g/mol. Its IUPAC name is tert-butyl-[(7E)-8-iodo-7-methylocta-1,7-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(7E)-8-iodo-7-methylocta-1,7-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 72737464 |
| Molecular Formula | C15H29IOSi |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | tert-butyl-[(7E)-8-iodo-7-methylocta-1,7-dien-3-yl]oxy-dimethylsilane |
| SMILES | C=CC(CCC/C(C)=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29IOSi/c1-8-14(11-9-10-13(2)12-16)17-18(6,7)15(3,4)5/h8,12,14H,1,9-11H2,2-7H3/b13-12+ |
| InChIKey | AFONGDFJTCASRS-OUKQBFOZSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|