C13H27IOSi — CID 10882748
tert-butyl-[(E,2R)-5-iodo-2,4-dimethylpent-4-enoxy]-dimethylsilane (PubChem CID 10882748) has the molecular formula C13H27IOSi and a molecular weight of 354.35 g/mol. Its IUPAC name is tert-butyl-[(E,2R)-5-iodo-2,4-dimethylpent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R)-5-iodo-2,4-dimethylpent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10882748 |
| Molecular Formula | C13H27IOSi |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | tert-butyl-[(E,2R)-5-iodo-2,4-dimethylpent-4-enoxy]-dimethylsilane |
| SMILES | C/C(=C\I)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27IOSi/c1-11(9-14)8-12(2)10-15-16(6,7)13(3,4)5/h9,12H,8,10H2,1-7H3/b11-9+/t12-/m1/s1 |
| InChIKey | UBSFXLWPICWATM-LMMOQWNQSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|