C12H11NO6 — CID 121003860
methyl (E)-3-(3-hydroxy-6-nitro-2,3-dihydro-1-benzofuran-2-yl)prop-2-enoate (PubChem CID 121003860) has the molecular formula C12H11NO6 and a molecular weight of 265.22 g/mol. Its IUPAC name is methyl (E)-3-(3-hydroxy-6-nitro-2,3-dihydro-1-benzofuran-2-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(3-hydroxy-6-nitro-2,3-dihydro-1-benzofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 121003860 |
| Molecular Formula | C12H11NO6 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | methyl (E)-3-(3-hydroxy-6-nitro-2,3-dihydro-1-benzofuran-2-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C/C1Oc2cc([N+](=O)[O-])ccc2C1O |
| InChI | InChI=1S/C12H11NO6/c1-18-11(14)5-4-9-12(15)8-3-2-7(13(16)17)6-10(8)19-9/h2-6,9,12,15H,1H3/b5-4+ |
| InChIKey | VEKCAWJEFKVQHK-SNAWJCMRSA-N |
| XLogP | 1.12 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|