C16H14Cl2O — CID 121005129
2,3-dichloro-3-(2-methoxyphenyl)-1,2-dihydroindene (PubChem CID 121005129) has the molecular formula C16H14Cl2O and a molecular weight of 293.19 g/mol. Its IUPAC name is 2,3-dichloro-3-(2-methoxyphenyl)-1,2-dihydroindene.
| Compound Name | 2,3-dichloro-3-(2-methoxyphenyl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 121005129 |
| Molecular Formula | C16H14Cl2O |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2,3-dichloro-3-(2-methoxyphenyl)-1,2-dihydroindene |
| SMILES | COc1ccccc1C1(Cl)c2ccccc2CC1Cl |
| InChI | InChI=1S/C16H14Cl2O/c1-19-14-9-5-4-8-13(14)16(18)12-7-3-2-6-11(12)10-15(16)17/h2-9,15H,10H2,1H3 |
| InChIKey | YQSDJWYHMSMJMK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|