C12H22S — CID 121007950
4,5-dibutyl-2,3-dihydrothiophene (PubChem CID 121007950) has the molecular formula C12H22S and a molecular weight of 198.37 g/mol. Its IUPAC name is 4,5-dibutyl-2,3-dihydrothiophene.
| Compound Name | 4,5-dibutyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 121007950 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 4,5-dibutyl-2,3-dihydrothiophene |
| SMILES | CCCCC1=C(CCCC)SCC1 |
| InChI | InChI=1S/C12H22S/c1-3-5-7-11-9-10-13-12(11)8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | KXRSKSYDBVYKPV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |