C10H16S — CID 57037159
3-(4-methylpent-3-enyl)-2,5-dihydrothiophene (PubChem CID 57037159) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene.
| Compound Name | 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene |
|---|---|
| PubChem CID | 57037159 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene |
| SMILES | CC(C)=CCCC1=CCSC1 |
| InChI | InChI=1S/C10H16S/c1-9(2)4-3-5-10-6-7-11-8-10/h4,6H,3,5,7-8H2,1-2H3 |
| InChIKey | XVGAFAVFBJIMRP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|