C12H14N2S — CID 121011581
1,3,5-trimethyl-4-phenylsulfanylpyrazole (PubChem CID 121011581) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is 1,3,5-trimethyl-4-phenylsulfanylpyrazole.
| Compound Name | 1,3,5-trimethyl-4-phenylsulfanylpyrazole |
|---|---|
| PubChem CID | 121011581 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1,3,5-trimethyl-4-phenylsulfanylpyrazole |
| SMILES | Cc1nn(C)c(C)c1Sc1ccccc1 |
| InChI | InChI=1S/C12H14N2S/c1-9-12(10(2)14(3)13-9)15-11-7-5-4-6-8-11/h4-8H,1-3H3 |
| InChIKey | AKISQSNLMQFROH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |