C12H13BrN2S — CID 701764
4-(4-bromophenyl)sulfanyl-1,3,5-trimethylpyrazole (PubChem CID 701764) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfanyl-1,3,5-trimethylpyrazole.
| Compound Name | 4-(4-bromophenyl)sulfanyl-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 701764 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 4-(4-bromophenyl)sulfanyl-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrN2S/c1-8-12(9(2)15(3)14-8)16-11-6-4-10(13)5-7-11/h4-7H,1-3H3 |
| InChIKey | OBAPCALKAKTEGI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |