C12H10BrN3S — CID 121002271
[1-(4-bromophenyl)-3,5-dimethylpyrazol-4-yl] thiocyanate (PubChem CID 121002271) has the molecular formula C12H10BrN3S and a molecular weight of 308.20 g/mol. Its IUPAC name is [1-(4-bromophenyl)-3,5-dimethylpyrazol-4-yl] thiocyanate.
| Compound Name | [1-(4-bromophenyl)-3,5-dimethylpyrazol-4-yl] thiocyanate |
|---|---|
| PubChem CID | 121002271 |
| Molecular Formula | C12H10BrN3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | [1-(4-bromophenyl)-3,5-dimethylpyrazol-4-yl] thiocyanate |
| SMILES | Cc1nn(-c2ccc(Br)cc2)c(C)c1SC#N |
| InChI | InChI=1S/C12H10BrN3S/c1-8-12(17-7-14)9(2)16(15-8)11-5-3-10(13)4-6-11/h3-6H,1-2H3 |
| InChIKey | WOGVELMADASEGH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|