C12H19NO4 — CID 121011693
3-[(E)-8-methoxyoct-7-enoyl]-1,3-oxazolidin-2-one (PubChem CID 121011693) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[(E)-8-methoxyoct-7-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-8-methoxyoct-7-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 121011693 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-[(E)-8-methoxyoct-7-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CO/C=C/CCCCCC(=O)N1CCOC1=O |
| InChI | InChI=1S/C12H19NO4/c1-16-9-6-4-2-3-5-7-11(14)13-8-10-17-12(13)15/h6,9H,2-5,7-8,10H2,1H3/b9-6+ |
| InChIKey | NUBBHGATWUNXHD-RMKNXTFCSA-N |
| XLogP | 2.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|