C11H17NO4 — CID 131887030
3-(7-methoxyhept-6-enoyl)-1,3-oxazolidin-2-one (PubChem CID 131887030) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-(7-methoxyhept-6-enoyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(7-methoxyhept-6-enoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 131887030 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-(7-methoxyhept-6-enoyl)-1,3-oxazolidin-2-one |
| SMILES | COC=CCCCCC(=O)N1CCOC1=O |
| InChI | InChI=1S/C11H17NO4/c1-15-8-5-3-2-4-6-10(13)12-7-9-16-11(12)14/h5,8H,2-4,6-7,9H2,1H3 |
| InChIKey | OKWODQVYDCGFBQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|