C12H21NO2 — CID 121012434
N-[(4R,6R)-6-hydroxynon-1-en-4-yl]prop-2-enamide (PubChem CID 121012434) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is N-[(4R,6R)-6-hydroxynon-1-en-4-yl]prop-2-enamide.
| Compound Name | N-[(4R,6R)-6-hydroxynon-1-en-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 121012434 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-[(4R,6R)-6-hydroxynon-1-en-4-yl]prop-2-enamide |
| SMILES | C=CC[C@H](C[C@H](O)CCC)NC(=O)C=C |
| InChI | InChI=1S/C12H21NO2/c1-4-7-10(13-12(15)6-3)9-11(14)8-5-2/h4,6,10-11,14H,1,3,5,7-9H2,2H3,(H,13,15)/t10-,11-/m1/s1 |
| InChIKey | GYKBSOIOVARSNX-GHMZBOCLSA-N |
| XLogP | 1.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|