C12H12N2O2 — CID 121012452
methyl (E)-2,3-bis(1H-pyrrol-2-yl)prop-2-enoate (PubChem CID 121012452) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl (E)-2,3-bis(1H-pyrrol-2-yl)prop-2-enoate.
| Compound Name | methyl (E)-2,3-bis(1H-pyrrol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 121012452 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | methyl (E)-2,3-bis(1H-pyrrol-2-yl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C12H12N2O2/c1-16-12(15)10(11-5-3-7-14-11)8-9-4-2-6-13-9/h2-8,13-14H,1H3/b10-8+ |
| InChIKey | PAJZPPFXOATLHP-CSKARUKUSA-N |
| XLogP | 2.06 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|