About 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate
2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate (PubChem CID 71438284) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate |
| PubChem CID | 71438284 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate |
| SMILES | C=CC(C)(C)OC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C10H13NO2/c1-4-10(2,3)13-9(12)8-6-5-7-11-8/h4-7,11H,1H2,2-3H3 |
| InChIKey | NAZLYNLXIKLORM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate?
The IUPAC name of 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate (CID 71438284) is 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate.
What is the SMILES notation for 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate?
The canonical SMILES for 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate is C=CC(C)(C)OC(=O)c1ccc[nH]1.
What is the InChIKey of 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate?
The InChIKey is NAZLYNLXIKLORM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-4-10(2,3)13-9(12)8-6-5-7-11-8/h4-7,11H,1H2,2-3H3.
What are the key properties of 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate?
2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate has a molecular weight of 179.22 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-en-2-yl 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 71438284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).