About (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate
(2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate (PubChem CID 174926523) has the molecular formula C12H11NO4S
and a molecular weight of 265.29 g/mol. Its IUPAC name is (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate |
| PubChem CID | 174926523 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate |
| SMILES | CS(=O)(=O)c1ccccc1OC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C12H11NO4S/c1-18(15,16)11-7-3-2-6-10(11)17-12(14)9-5-4-8-13-9/h2-8,13H,1H3 |
| InChIKey | IGQNMNKFHAHOBF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate?
The IUPAC name of (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate (CID 174926523) is (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate.
What is the SMILES notation for (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate?
The canonical SMILES for (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate is CS(=O)(=O)c1ccccc1OC(=O)c1ccc[nH]1.
What is the InChIKey of (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate?
The InChIKey is IGQNMNKFHAHOBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4S/c1-18(15,16)11-7-3-2-6-10(11)17-12(14)9-5-4-8-13-9/h2-8,13H,1H3.
What are the key properties of (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate?
(2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate has a molecular weight of 265.29 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfonylphenyl) 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 174926523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).